![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 0.5x IC50 of Pt2 (Light)/ | 2025-04-14 09:06 | - | |
| 0.25x IC50 of Pt2 (Light)/ | 2025-04-14 09:03 | - | |
| 1x IC50 of Pt2 (Dark)/ | 2025-04-14 09:15 | - | |
| 1x IC50 of Pt2 (Light) + 2 h recovery/ | 2025-04-14 11:50 | - | |
| 1x IC50 of Pt2 (Light)/ | 2025-04-14 09:25 | - | |
| Tomogram 1 | 2025-04-14 09:29 | 30M | |
| Tomogram 2 | 2025-04-14 09:31 | 28M | |
| Tomogram 3 | 2025-04-14 09:31 | 76M | |
| Tomogram 3 (Segmented) | 2025-04-14 09:31 | 29M | |
| Tomogram 4 | 2025-04-14 09:31 | 33M | |
| Tomogram 5 | 2025-04-14 09:31 | 37M | |
| Tomogram 6 | 2025-04-14 09:31 | 22M | |
| Tomogram 7 | 2025-04-14 09:32 | 27M | |
| Tomogram 8 | 2025-04-14 09:32 | 49M | |
| Tomogram 9 | 2025-04-14 09:32 | 50M | |
| Tomogram 12 | 2025-04-14 09:29 | 19M | |
| Tomogram 13 | 2025-04-14 09:29 | 54M | |
| Tomogram 14 | 2025-04-14 09:29 | 38M | |
| Tomogram 15 | 2025-04-14 09:30 | 70M | |
| Tomogram 16 | 2025-04-14 09:30 | 85M | |
| Tomogram 16 (Segmented) | 2025-04-14 09:30 | 24M | |
| Tomogram 17 | 2025-04-14 09:30 | 183M | |
| Tomogram 18 | 2025-04-14 09:30 | 46M | |
| Tomogram 19 | 2025-04-14 09:31 | 51M | |
| Tomogram T10 | 2025-04-14 09:32 | 54M | |
| Tomogram T11 | 2025-04-14 09:33 | 23M | |
| Untreated Control (Dark)/ | 2025-04-14 09:38 | - | |
| Untreated Control (Light)/ | 2025-04-14 09:48 | - | |